C29H34F3NO4S — CID 123277048
2-(2,6-diethyl-4-methylphenyl)-3-[hydroxy(prop-2-enoxy)methoxy]-5-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]cyclohex-2-en-1-one (PubChem CID 123277048) has the molecular formula C29H34F3NO4S and a molecular weight of 549.66 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-methylphenyl)-3-[hydroxy(prop-2-enoxy)methoxy]-5-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]cyclohex-2-en-1-one.
| Compound Name | 2-(2,6-diethyl-4-methylphenyl)-3-[hydroxy(prop-2-enoxy)methoxy]-5-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 123277048 |
| Molecular Formula | C29H34F3NO4S |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.22 |
| IUPAC Name | 2-(2,6-diethyl-4-methylphenyl)-3-[hydroxy(prop-2-enoxy)methoxy]-5-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]cyclohex-2-en-1-one |
| SMILES | C=CCOC(O)OC1=C(c2c(CC)cc(C)cc2CC)C(=O)CC(CCSc2ccc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C29H34F3NO4S/c1-5-11-36-28(35)37-24-16-19(10-12-38-25-9-8-22(17-33-25)29(30,31)32)15-23(34)27(24)26-20(6-2)13-18(4)14-21(26)7-3/h5,8-9,13-14,17,19,28,35H,1,6-7,10-12,15-16H2,2-4H3 |
| InChIKey | CKXKKYHNJXVBMT-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|