C23H24F3NO2S — CID 123583931
5-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione (PubChem CID 123583931) has the molecular formula C23H24F3NO2S and a molecular weight of 435.51 g/mol. Its IUPAC name is 5-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione.
| Compound Name | 5-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123583931 |
| Molecular Formula | C23H24F3NO2S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 5-[2-[[5-(trifluoromethyl)-2-pyridinyl]sulfanyl]ethyl]-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CCSc3ccc(C(F)(F)F)cn3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C23H24F3NO2S/c1-13-8-14(2)21(15(3)9-13)22-18(28)10-16(11-19(22)29)6-7-30-20-5-4-17(12-27-20)23(24,25)26/h4-5,8-9,12,16,22H,6-7,10-11H2,1-3H3 |
| InChIKey | PEIMIUYTHQNHBL-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|