C26H29F3O3S — CID 123617069
2-(2,6-diethyl-4-methylphenyl)-5-[2-[4-(trifluoromethyl)phenyl]sulfinylethyl]cyclohexane-1,3-dione (PubChem CID 123617069) has the molecular formula C26H29F3O3S and a molecular weight of 478.58 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-methylphenyl)-5-[2-[4-(trifluoromethyl)phenyl]sulfinylethyl]cyclohexane-1,3-dione.
| Compound Name | 2-(2,6-diethyl-4-methylphenyl)-5-[2-[4-(trifluoromethyl)phenyl]sulfinylethyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123617069 |
| Molecular Formula | C26H29F3O3S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 2-(2,6-diethyl-4-methylphenyl)-5-[2-[4-(trifluoromethyl)phenyl]sulfinylethyl]cyclohexane-1,3-dione |
| SMILES | CCc1cc(C)cc(CC)c1C1C(=O)CC(CCS(=O)c2ccc(C(F)(F)F)cc2)CC1=O |
| InChI | InChI=1S/C26H29F3O3S/c1-4-18-12-16(3)13-19(5-2)24(18)25-22(30)14-17(15-23(25)31)10-11-33(32)21-8-6-20(7-9-21)26(27,28)29/h6-9,12-13,17,25H,4-5,10-11,14-15H2,1-3H3 |
| InChIKey | BGFOXHNXWPBZLU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|