C23H34O2S — CID 91510420
2-(2,6-diethyl-4-methylphenyl)-5-(2-propylsulfanylpropyl)cyclohexane-1,3-dione (PubChem CID 91510420) has the molecular formula C23H34O2S and a molecular weight of 374.59 g/mol. Its IUPAC name is 2-(2,6-diethyl-4-methylphenyl)-5-(2-propylsulfanylpropyl)cyclohexane-1,3-dione.
| Compound Name | 2-(2,6-diethyl-4-methylphenyl)-5-(2-propylsulfanylpropyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 91510420 |
| Molecular Formula | C23H34O2S |
| Molecular Weight | 374.59 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 2-(2,6-diethyl-4-methylphenyl)-5-(2-propylsulfanylpropyl)cyclohexane-1,3-dione |
| SMILES | CCCSC(C)CC1CC(=O)C(c2c(CC)cc(C)cc2CC)C(=O)C1 |
| InChI | InChI=1S/C23H34O2S/c1-6-9-26-16(5)12-17-13-20(24)23(21(25)14-17)22-18(7-2)10-15(4)11-19(22)8-3/h10-11,16-17,23H,6-9,12-14H2,1-5H3 |
| InChIKey | DWCOUJLCOFDKDP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.59 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|