C21H28O3 — CID 91158954
5-(oxan-4-ylmethyl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione (PubChem CID 91158954) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is 5-(oxan-4-ylmethyl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione.
| Compound Name | 5-(oxan-4-ylmethyl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 91158954 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 5-(oxan-4-ylmethyl)-2-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CCOCC3)CC2=O)c(C)c1 |
| InChI | InChI=1S/C21H28O3/c1-13-8-14(2)20(15(3)9-13)21-18(22)11-17(12-19(21)23)10-16-4-6-24-7-5-16/h8-9,16-17,21H,4-7,10-12H2,1-3H3 |
| InChIKey | ZZDKOURLLVLROC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|