C23H33NO4S — CID 58481515
4-[(1-propan-2-ylsulfonylpiperidin-4-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 58481515) has the molecular formula C23H33NO4S and a molecular weight of 419.59 g/mol. Its IUPAC name is 4-[(1-propan-2-ylsulfonylpiperidin-4-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[(1-propan-2-ylsulfonylpiperidin-4-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481515 |
| Molecular Formula | C23H33NO4S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-[(1-propan-2-ylsulfonylpiperidin-4-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CCN(S(=O)(=O)C(C)C)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C23H33NO4S/c1-14(2)29(27,28)24-8-6-18(7-9-24)12-19-13-20(25)22(23(19)26)21-16(4)10-15(3)11-17(21)5/h10-11,14,18-19,22H,6-9,12-13H2,1-5H3 |
| InChIKey | UPXJQOJROZVOAM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|