C16H22NO2+ — CID 140707308
2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethylazanium (PubChem CID 140707308) has the molecular formula C16H22NO2+ and a molecular weight of 260.36 g/mol. Its IUPAC name is 2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethylazanium.
| Compound Name | 2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethylazanium |
|---|---|
| PubChem CID | 140707308 |
| Molecular Formula | C16H22NO2+ |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethylazanium |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC[NH3+])C2=O)c(C)c1 |
| InChI | InChI=1S/C16H21NO2/c1-9-6-10(2)14(11(3)7-9)15-13(18)8-12(4-5-17)16(15)19/h6-7,12,15H,4-5,8,17H2,1-3H3/p+1 |
| InChIKey | ZKGBJAKMIMPTCP-UHFFFAOYSA-O |
| XLogP | 1.49 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|