C22H28N2O4 — CID 130362921
N-[2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethyl]-5,5-dimethyl-4H-1,2-oxazole-3-carboxamide (PubChem CID 130362921) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-[2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethyl]-5,5-dimethyl-4H-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethyl]-5,5-dimethyl-4H-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 130362921 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethyl]-5,5-dimethyl-4H-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CCNC(=O)C3=NOC(C)(C)C3)C2=O)c(C)c1 |
| InChI | InChI=1S/C22H28N2O4/c1-12-8-13(2)18(14(3)9-12)19-17(25)10-15(20(19)26)6-7-23-21(27)16-11-22(4,5)28-24-16/h8-9,15,19H,6-7,10-11H2,1-5H3,(H,23,27) |
| InChIKey | QUPCCKDVQCAAGI-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|