C22H26N2O3 — CID 118967929
N-[2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethyl]-1-methylpyrrole-2-carboxamide (PubChem CID 118967929) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 118967929 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[2-[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]ethyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CCNC(=O)c3cccn3C)C2=O)c(C)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-13-10-14(2)19(15(3)11-13)20-18(25)12-16(21(20)26)7-8-23-22(27)17-6-5-9-24(17)4/h5-6,9-11,16,20H,7-8,12H2,1-4H3,(H,23,27) |
| InChIKey | ZQIKMICFCGUIDK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|