C22H24N2O4 — CID 118967942
N-[2-[3-(4-methoxy-2,6-dimethylphenyl)-2,4-dioxocyclopentyl]ethyl]pyridine-2-carboxamide (PubChem CID 118967942) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-[2-[3-(4-methoxy-2,6-dimethylphenyl)-2,4-dioxocyclopentyl]ethyl]pyridine-2-carboxamide.
| Compound Name | N-[2-[3-(4-methoxy-2,6-dimethylphenyl)-2,4-dioxocyclopentyl]ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118967942 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[2-[3-(4-methoxy-2,6-dimethylphenyl)-2,4-dioxocyclopentyl]ethyl]pyridine-2-carboxamide |
| SMILES | COc1cc(C)c(C2C(=O)CC(CCNC(=O)c3ccccn3)C2=O)c(C)c1 |
| InChI | InChI=1S/C22H24N2O4/c1-13-10-16(28-3)11-14(2)19(13)20-18(25)12-15(21(20)26)7-9-24-22(27)17-6-4-5-8-23-17/h4-6,8,10-11,15,20H,7,9,12H2,1-3H3,(H,24,27) |
| InChIKey | STZHTGMQMPGHNS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|