C27H31NO3S — CID 58481632
S-phenyl 4-[[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]methyl]piperidine-1-carbothioate (PubChem CID 58481632) has the molecular formula C27H31NO3S and a molecular weight of 449.62 g/mol. Its IUPAC name is S-phenyl 4-[[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]methyl]piperidine-1-carbothioate.
| Compound Name | S-phenyl 4-[[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]methyl]piperidine-1-carbothioate |
|---|---|
| PubChem CID | 58481632 |
| Molecular Formula | C27H31NO3S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | S-phenyl 4-[[2,4-dioxo-3-(2,4,6-trimethylphenyl)cyclopentyl]methyl]piperidine-1-carbothioate |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CCN(C(=O)Sc4ccccc4)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C27H31NO3S/c1-17-13-18(2)24(19(3)14-17)25-23(29)16-21(26(25)30)15-20-9-11-28(12-10-20)27(31)32-22-7-5-4-6-8-22/h4-8,13-14,20-21,25H,9-12,15-16H2,1-3H3 |
| InChIKey | REINIRJMGXDFOC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|