C24H32ClNO3 — CID 58481486
4-[[1-(3-chloro-2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 58481486) has the molecular formula C24H32ClNO3 and a molecular weight of 417.98 g/mol. Its IUPAC name is 4-[[1-(3-chloro-2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[[1-(3-chloro-2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481486 |
| Molecular Formula | C24H32ClNO3 |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 4-[[1-(3-chloro-2,2-dimethylpropanoyl)pyrrolidin-3-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CCN(C(=O)C(C)(C)CCl)C3)C2=O)c(C)c1 |
| InChI | InChI=1S/C24H32ClNO3/c1-14-8-15(2)20(16(3)9-14)21-19(27)11-18(22(21)28)10-17-6-7-26(12-17)23(29)24(4,5)13-25/h8-9,17-18,21H,6-7,10-13H2,1-5H3 |
| InChIKey | WRBXRMPQKXSRDZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|