C21H29NO4S — CID 58481494
4-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 58481494) has the molecular formula C21H29NO4S and a molecular weight of 391.53 g/mol. Its IUPAC name is 4-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 58481494 |
| Molecular Formula | C21H29NO4S |
| Molecular Weight | 391.53 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 4-[(1-methylsulfonylpiperidin-4-yl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3CCN(S(C)(=O)=O)CC3)C2=O)c(C)c1 |
| InChI | InChI=1S/C21H29NO4S/c1-13-9-14(2)19(15(3)10-13)20-18(23)12-17(21(20)24)11-16-5-7-22(8-6-16)27(4,25)26/h9-10,16-17,20H,5-8,11-12H2,1-4H3 |
| InChIKey | UKRPACVTXZWZEQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.53 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|