C23H25NO5 — CID 123578092
4-[[(4R,7S)-1,3-dihydroxy-4,5,6,7-tetrahydro-2H-4,7-epoxyisoindol-5-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 123578092) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-[[(4R,7S)-1,3-dihydroxy-4,5,6,7-tetrahydro-2H-4,7-epoxyisoindol-5-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[[(4R,7S)-1,3-dihydroxy-4,5,6,7-tetrahydro-2H-4,7-epoxyisoindol-5-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 123578092 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 4-[[(4R,7S)-1,3-dihydroxy-4,5,6,7-tetrahydro-2H-4,7-epoxyisoindol-5-yl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(CC3C[C@@H]4O[C@H]3c3c(O)[nH]c(O)c34)C2=O)c(C)c1 |
| InChI | InChI=1S/C23H25NO5/c1-9-4-10(2)16(11(3)5-9)17-14(25)7-12(20(17)26)6-13-8-15-18-19(21(13)29-15)23(28)24-22(18)27/h4-5,12-13,15,17,21,24,27-28H,6-8H2,1-3H3/t12?,13?,15-,17?,21+/m0/s1 |
| InChIKey | HYPANGDWKJKRPK-QJHHFAJHSA-N |
| XLogP | 3.82 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|