C24H33NO2 — CID 145066495
4-[2-(3,5-dimethylpiperidin-1-yl)prop-2-enyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 145066495) has the molecular formula C24H33NO2 and a molecular weight of 367.53 g/mol. Its IUPAC name is 4-[2-(3,5-dimethylpiperidin-1-yl)prop-2-enyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[2-(3,5-dimethylpiperidin-1-yl)prop-2-enyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 145066495 |
| Molecular Formula | C24H33NO2 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 4-[2-(3,5-dimethylpiperidin-1-yl)prop-2-enyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | C=C(CC1CC(=O)C(c2c(C)cc(C)cc2C)C1=O)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C24H33NO2/c1-14-8-17(4)22(18(5)9-14)23-21(26)11-20(24(23)27)10-19(6)25-12-15(2)7-16(3)13-25/h8-9,15-16,20,23H,6-7,10-13H2,1-5H3 |
| InChIKey | QTHAEMVZSSNRAF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|