C22H31NO2 — CID 145066444
N-cyclopentyl-2-[2-methylidene-4-oxo-3-(2,4,6-trimethylphenyl)cyclopentyl]acetamide;molecular hydrogen (PubChem CID 145066444) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is N-cyclopentyl-2-[2-methylidene-4-oxo-3-(2,4,6-trimethylphenyl)cyclopentyl]acetamide;molecular hydrogen.
| Compound Name | N-cyclopentyl-2-[2-methylidene-4-oxo-3-(2,4,6-trimethylphenyl)cyclopentyl]acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 145066444 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | N-cyclopentyl-2-[2-methylidene-4-oxo-3-(2,4,6-trimethylphenyl)cyclopentyl]acetamide;molecular hydrogen |
| SMILES | C=C1C(CC(=O)NC2CCCC2)CC(=O)C1c1c(C)cc(C)cc1C.[H][H] |
| InChI | InChI=1S/C22H29NO2.H2/c1-13-9-14(2)21(15(3)10-13)22-16(4)17(11-19(22)24)12-20(25)23-18-7-5-6-8-18;/h9-10,17-18,22H,4-8,11-12H2,1-3H3,(H,23,25);1H |
| InChIKey | FCQLYQLTLDRVOE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|