C18H20O2 — CID 121322571
4-but-2-ynyl-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 121322571) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-but-2-ynyl-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-but-2-ynyl-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 121322571 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-but-2-ynyl-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | CC#CCC1CC(=O)C(c2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C18H20O2/c1-5-6-7-14-10-15(19)17(18(14)20)16-12(3)8-11(2)9-13(16)4/h8-9,14,17H,7,10H2,1-4H3 |
| InChIKey | BNHNCNBILWBUKG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|