C29H36B2F3NO7S — CID 123278556
[4-(5-methylquinolin-8-yl)phenyl] trifluoromethanesulfonate;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane (PubChem CID 123278556) has the molecular formula C29H36B2F3NO7S and a molecular weight of 621.29 g/mol. Its IUPAC name is [4-(5-methylquinolin-8-yl)phenyl] trifluoromethanesulfonate;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane.
| Compound Name | [4-(5-methylquinolin-8-yl)phenyl] trifluoromethanesulfonate;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 123278556 |
| Molecular Formula | C29H36B2F3NO7S |
| Molecular Weight | 621.29 g/mol |
| Exact Mass | 621.24 |
| IUPAC Name | [4-(5-methylquinolin-8-yl)phenyl] trifluoromethanesulfonate;4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C.Cc1ccc(-c2ccc(OS(=O)(=O)C(F)(F)F)cc2)c2ncccc12 |
| InChI | InChI=1S/C17H12F3NO3S.C12H24B2O4/c1-11-4-9-15(16-14(11)3-2-10-21-16)12-5-7-13(8-6-12)24-25(22,23)17(18,19)20;1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14/h2-10H,1H3;1-8H3 |
| InChIKey | ULGWPJODAXVWDK-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 93.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.29 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|