C19H22F4O2 — CID 123283046
1-[5-cyclopropyl-2-fluoro-4-[[1-(trifluoromethyl)cyclohexyl]methoxy]phenyl]ethanone (PubChem CID 123283046) has the molecular formula C19H22F4O2 and a molecular weight of 358.38 g/mol. Its IUPAC name is 1-[5-cyclopropyl-2-fluoro-4-[[1-(trifluoromethyl)cyclohexyl]methoxy]phenyl]ethanone.
| Compound Name | 1-[5-cyclopropyl-2-fluoro-4-[[1-(trifluoromethyl)cyclohexyl]methoxy]phenyl]ethanone |
|---|---|
| PubChem CID | 123283046 |
| Molecular Formula | C19H22F4O2 |
| Molecular Weight | 358.38 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 1-[5-cyclopropyl-2-fluoro-4-[[1-(trifluoromethyl)cyclohexyl]methoxy]phenyl]ethanone |
| SMILES | CC(=O)c1cc(C2CC2)c(OCC2(C(F)(F)F)CCCCC2)cc1F |
| InChI | InChI=1S/C19H22F4O2/c1-12(24)14-9-15(13-5-6-13)17(10-16(14)20)25-11-18(19(21,22)23)7-3-2-4-8-18/h9-10,13H,2-8,11H2,1H3 |
| InChIKey | BWQRNAMYDFYXAM-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |