C21H24F4N2O4S — CID 162592768
N-(azetidin-1-ylsulfonyl)-5-cycloprop-2-en-1-yl-2-fluoro-4-[[1-(trifluoromethyl)cyclohexyl]methoxy]benzamide (PubChem CID 162592768) has the molecular formula C21H24F4N2O4S and a molecular weight of 476.49 g/mol. Its IUPAC name is N-(azetidin-1-ylsulfonyl)-5-cycloprop-2-en-1-yl-2-fluoro-4-[[1-(trifluoromethyl)cyclohexyl]methoxy]benzamide.
| Compound Name | N-(azetidin-1-ylsulfonyl)-5-cycloprop-2-en-1-yl-2-fluoro-4-[[1-(trifluoromethyl)cyclohexyl]methoxy]benzamide |
|---|---|
| PubChem CID | 162592768 |
| Molecular Formula | C21H24F4N2O4S |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | N-(azetidin-1-ylsulfonyl)-5-cycloprop-2-en-1-yl-2-fluoro-4-[[1-(trifluoromethyl)cyclohexyl]methoxy]benzamide |
| SMILES | O=C(NS(=O)(=O)N1CCC1)c1cc(C2C=C2)c(OCC2(C(F)(F)F)CCCCC2)cc1F |
| InChI | InChI=1S/C21H24F4N2O4S/c22-17-12-18(31-13-20(21(23,24)25)7-2-1-3-8-20)15(14-5-6-14)11-16(17)19(28)26-32(29,30)27-9-4-10-27/h5-6,11-12,14H,1-4,7-10,13H2,(H,26,28) |
| InChIKey | SMVNZEISDIDYTG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|