C23H33FN2O4S — CID 130457843
5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluoro-N-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 130457843) has the molecular formula C23H33FN2O4S and a molecular weight of 452.59 g/mol. Its IUPAC name is 5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluoro-N-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | 5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluoro-N-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 130457843 |
| Molecular Formula | C23H33FN2O4S |
| Molecular Weight | 452.59 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluoro-N-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | C=CCC(CC)(CC)COc1cc(F)c(C(=O)NS(=O)(=O)N2CCCC2)cc1C1CC1 |
| InChI | InChI=1S/C23H33FN2O4S/c1-4-11-23(5-2,6-3)16-30-21-15-20(24)19(14-18(21)17-9-10-17)22(27)25-31(28,29)26-12-7-8-13-26/h4,14-15,17H,1,5-13,16H2,2-3H3,(H,25,27) |
| InChIKey | VCHYLVUPWOINEZ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|