C26H36FNO4 — CID 137458320
1-[5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzoyl]-5,5-dimethylpyrrolidine-2-carboxylic acid (PubChem CID 137458320) has the molecular formula C26H36FNO4 and a molecular weight of 445.58 g/mol. Its IUPAC name is 1-[5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzoyl]-5,5-dimethylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-[5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzoyl]-5,5-dimethylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 137458320 |
| Molecular Formula | C26H36FNO4 |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 1-[5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzoyl]-5,5-dimethylpyrrolidine-2-carboxylic acid |
| SMILES | C=CCC(CC)(CC)COc1cc(F)c(C(=O)N2C(C(=O)O)CCC2(C)C)cc1C1CC1 |
| InChI | InChI=1S/C26H36FNO4/c1-6-12-26(7-2,8-3)16-32-22-15-20(27)19(14-18(22)17-9-10-17)23(29)28-21(24(30)31)11-13-25(28,4)5/h6,14-15,17,21H,1,7-13,16H2,2-5H3,(H,30,31) |
| InChIKey | OPDYRVGYSMUXEQ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|