C22H30FNO4S — CID 130457764
5-cyclopropyl-N-cyclopropylsulfonyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzamide (PubChem CID 130457764) has the molecular formula C22H30FNO4S and a molecular weight of 423.55 g/mol. Its IUPAC name is 5-cyclopropyl-N-cyclopropylsulfonyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzamide.
| Compound Name | 5-cyclopropyl-N-cyclopropylsulfonyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzamide |
|---|---|
| PubChem CID | 130457764 |
| Molecular Formula | C22H30FNO4S |
| Molecular Weight | 423.55 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 5-cyclopropyl-N-cyclopropylsulfonyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzamide |
| SMILES | C=CCC(CC)(CC)COc1cc(F)c(C(=O)NS(=O)(=O)C2CC2)cc1C1CC1 |
| InChI | InChI=1S/C22H30FNO4S/c1-4-11-22(5-2,6-3)14-28-20-13-19(23)18(12-17(20)15-7-8-15)21(25)24-29(26,27)16-9-10-16/h4,12-13,15-16H,1,5-11,14H2,2-3H3,(H,24,25) |
| InChIKey | XIKPHSWMXJQHNF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|