C24H32FNO5 — CID 130192361
(4R,5S)-3-[5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzoyl]-5-methyl-1,3-oxazolidine-4-carboxylic acid (PubChem CID 130192361) has the molecular formula C24H32FNO5 and a molecular weight of 433.52 g/mol. Its IUPAC name is (4R,5S)-3-[5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzoyl]-5-methyl-1,3-oxazolidine-4-carboxylic acid.
| Compound Name | (4R,5S)-3-[5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzoyl]-5-methyl-1,3-oxazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 130192361 |
| Molecular Formula | C24H32FNO5 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | (4R,5S)-3-[5-cyclopropyl-4-(2,2-diethylpent-4-enoxy)-2-fluorobenzoyl]-5-methyl-1,3-oxazolidine-4-carboxylic acid |
| SMILES | C=CCC(CC)(CC)COc1cc(F)c(C(=O)N2CO[C@@H](C)[C@@H]2C(=O)O)cc1C1CC1 |
| InChI | InChI=1S/C24H32FNO5/c1-5-10-24(6-2,7-3)13-30-20-12-19(25)18(11-17(20)16-8-9-16)22(27)26-14-31-15(4)21(26)23(28)29/h5,11-12,15-16,21H,1,6-10,13-14H2,2-4H3,(H,28,29)/t15-,21+/m0/s1 |
| InChIKey | QLEHITWLAQJRID-YCRPNKLZSA-N |
| XLogP | 4.74 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|