C18H13N5O — CID 123283624
4-(3-pyridin-2-ylanilino)-3H-pyrido[2,3-d]pyrimidin-2-one (PubChem CID 123283624) has the molecular formula C18H13N5O and a molecular weight of 315.34 g/mol. Its IUPAC name is 4-(3-pyridin-2-ylanilino)-3H-pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4-(3-pyridin-2-ylanilino)-3H-pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 123283624 |
| Molecular Formula | C18H13N5O |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 4-(3-pyridin-2-ylanilino)-3H-pyrido[2,3-d]pyrimidin-2-one |
| SMILES | O=c1nc2ncccc2c(Nc2cccc(-c3ccccn3)c2)[nH]1 |
| InChI | InChI=1S/C18H13N5O/c24-18-22-16-14(7-4-10-20-16)17(23-18)21-13-6-3-5-12(11-13)15-8-1-2-9-19-15/h1-11H,(H2,20,21,22,23,24) |
| InChIKey | GHUNJLSQSDGZOX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |