C20H16N4O2 — CID 123765562
4-[3-(4-methoxyphenyl)anilino]-3H-pyrido[2,3-d]pyrimidin-2-one (PubChem CID 123765562) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-[3-(4-methoxyphenyl)anilino]-3H-pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4-[3-(4-methoxyphenyl)anilino]-3H-pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 123765562 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 4-[3-(4-methoxyphenyl)anilino]-3H-pyrido[2,3-d]pyrimidin-2-one |
| SMILES | COc1ccc(-c2cccc(Nc3[nH]c(=O)nc4ncccc34)c2)cc1 |
| InChI | InChI=1S/C20H16N4O2/c1-26-16-9-7-13(8-10-16)14-4-2-5-15(12-14)22-19-17-6-3-11-21-18(17)23-20(25)24-19/h2-12H,1H3,(H2,21,22,23,24,25) |
| InChIKey | UZTSLWGJAJXFGW-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |