C23H16N4O — CID 123990750
4-(4-naphthalen-2-ylanilino)-3H-pyrido[2,3-d]pyrimidin-2-one (PubChem CID 123990750) has the molecular formula C23H16N4O and a molecular weight of 364.41 g/mol. Its IUPAC name is 4-(4-naphthalen-2-ylanilino)-3H-pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 4-(4-naphthalen-2-ylanilino)-3H-pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 123990750 |
| Molecular Formula | C23H16N4O |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-(4-naphthalen-2-ylanilino)-3H-pyrido[2,3-d]pyrimidin-2-one |
| SMILES | O=c1nc2ncccc2c(Nc2ccc(-c3ccc4ccccc4c3)cc2)[nH]1 |
| InChI | InChI=1S/C23H16N4O/c28-23-26-21-20(6-3-13-24-21)22(27-23)25-19-11-9-16(10-12-19)18-8-7-15-4-1-2-5-17(15)14-18/h1-14H,(H2,24,25,26,27,28) |
| InChIKey | XPJZKGIJFKWQCO-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |