C12H16O4 — CID 123283686
methyl 2-[(5E)-4-ethylidene-5-(2-oxopropylidene)oxolan-3-yl]acetate (PubChem CID 123283686) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 2-[(5E)-4-ethylidene-5-(2-oxopropylidene)oxolan-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-4-ethylidene-5-(2-oxopropylidene)oxolan-3-yl]acetate |
|---|---|
| PubChem CID | 123283686 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl 2-[(5E)-4-ethylidene-5-(2-oxopropylidene)oxolan-3-yl]acetate |
| SMILES | CC=C1/C(=C\C(C)=O)OCC1CC(=O)OC |
| InChI | InChI=1S/C12H16O4/c1-4-10-9(6-12(14)15-3)7-16-11(10)5-8(2)13/h4-5,9H,6-7H2,1-3H3/b10-4?,11-5+ |
| InChIKey | WDMUAJXTCFTYSM-DRBLANJYSA-N |
| XLogP | 1.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|