C12H16O4 — CID 143601251
methyl 2-[(5E)-5-[(E)-2-hydroxybut-2-enylidene]-4-methylideneoxolan-3-yl]acetate (PubChem CID 143601251) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[(E)-2-hydroxybut-2-enylidene]-4-methylideneoxolan-3-yl]acetate.
| Compound Name | methyl 2-[(5E)-5-[(E)-2-hydroxybut-2-enylidene]-4-methylideneoxolan-3-yl]acetate |
|---|---|
| PubChem CID | 143601251 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | methyl 2-[(5E)-5-[(E)-2-hydroxybut-2-enylidene]-4-methylideneoxolan-3-yl]acetate |
| SMILES | C=C1/C(=C\C(O)=C/C)OCC1CC(=O)OC |
| InChI | InChI=1S/C12H16O4/c1-4-10(13)6-11-8(2)9(7-16-11)5-12(14)15-3/h4,6,9,13H,2,5,7H2,1,3H3/b10-4+,11-6+ |
| InChIKey | PIVLCOCSXUUTFM-MCIRJAFSSA-N |
| XLogP | 2.10 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|