C18H17ClFNO3 — CID 123284947
2-[2-(3-chloro-5-fluorophenyl)ethynyl]-4,9,12-trioxa-3-azadispiro[4.2.48.25]tetradec-1-ene (PubChem CID 123284947) has the molecular formula C18H17ClFNO3 and a molecular weight of 349.79 g/mol. Its IUPAC name is 2-[2-(3-chloro-5-fluorophenyl)ethynyl]-4,9,12-trioxa-3-azadispiro[4.2.48.25]tetradec-1-ene.
| Compound Name | 2-[2-(3-chloro-5-fluorophenyl)ethynyl]-4,9,12-trioxa-3-azadispiro[4.2.48.25]tetradec-1-ene |
|---|---|
| PubChem CID | 123284947 |
| Molecular Formula | C18H17ClFNO3 |
| Molecular Weight | 349.79 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 2-[2-(3-chloro-5-fluorophenyl)ethynyl]-4,9,12-trioxa-3-azadispiro[4.2.48.25]tetradec-1-ene |
| SMILES | Fc1cc(Cl)cc(C#CC2=CC3(CCC4(CC3)OCCO4)ON2)c1 |
| InChI | InChI=1S/C18H17ClFNO3/c19-14-9-13(10-15(20)11-14)1-2-16-12-17(24-21-16)3-5-18(6-4-17)22-7-8-23-18/h9-12,21H,3-8H2 |
| InChIKey | VOYAGSJOHDYONX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.79 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|