C19H18N2O3 — CID 123825540
3-[2-(4,9,12-trioxa-3-azadispiro[4.2.48.25]tetradec-1-en-2-yl)ethynyl]benzonitrile (PubChem CID 123825540) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[2-(4,9,12-trioxa-3-azadispiro[4.2.48.25]tetradec-1-en-2-yl)ethynyl]benzonitrile.
| Compound Name | 3-[2-(4,9,12-trioxa-3-azadispiro[4.2.48.25]tetradec-1-en-2-yl)ethynyl]benzonitrile |
|---|---|
| PubChem CID | 123825540 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-[2-(4,9,12-trioxa-3-azadispiro[4.2.48.25]tetradec-1-en-2-yl)ethynyl]benzonitrile |
| SMILES | N#Cc1cccc(C#CC2=CC3(CCC4(CC3)OCCO4)ON2)c1 |
| InChI | InChI=1S/C19H18N2O3/c20-14-16-3-1-2-15(12-16)4-5-17-13-18(24-21-17)6-8-19(9-7-18)22-10-11-23-19/h1-3,12-13,21H,6-11H2 |
| InChIKey | UXNXSIHRVUQQJS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|