C17H18ClN3O3 — CID 123485513
3-[2-(3-chlorophenyl)ethynyl]-N-methoxy-N-methyl-1-oxa-2,7-diazaspiro[4.4]non-3-ene-7-carboxamide (PubChem CID 123485513) has the molecular formula C17H18ClN3O3 and a molecular weight of 347.80 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethynyl]-N-methoxy-N-methyl-1-oxa-2,7-diazaspiro[4.4]non-3-ene-7-carboxamide.
| Compound Name | 3-[2-(3-chlorophenyl)ethynyl]-N-methoxy-N-methyl-1-oxa-2,7-diazaspiro[4.4]non-3-ene-7-carboxamide |
|---|---|
| PubChem CID | 123485513 |
| Molecular Formula | C17H18ClN3O3 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethynyl]-N-methoxy-N-methyl-1-oxa-2,7-diazaspiro[4.4]non-3-ene-7-carboxamide |
| SMILES | CON(C)C(=O)N1CCC2(C=C(C#Cc3cccc(Cl)c3)NO2)C1 |
| InChI | InChI=1S/C17H18ClN3O3/c1-20(23-2)16(22)21-9-8-17(12-21)11-15(19-24-17)7-6-13-4-3-5-14(18)10-13/h3-5,10-11,19H,8-9,12H2,1-2H3 |
| InChIKey | GQZFZSLIXRTHOZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|