C14H14N2O — CID 123630922
3-(2-phenylethynyl)-1-oxa-2,7-diazaspiro[4.4]non-3-ene (PubChem CID 123630922) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-(2-phenylethynyl)-1-oxa-2,7-diazaspiro[4.4]non-3-ene.
| Compound Name | 3-(2-phenylethynyl)-1-oxa-2,7-diazaspiro[4.4]non-3-ene |
|---|---|
| PubChem CID | 123630922 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-(2-phenylethynyl)-1-oxa-2,7-diazaspiro[4.4]non-3-ene |
| SMILES | C(#Cc1ccccc1)C1=CC2(CCNC2)ON1 |
| InChI | InChI=1S/C14H14N2O/c1-2-4-12(5-3-1)6-7-13-10-14(17-16-13)8-9-15-11-14/h1-5,10,15-16H,8-9,11H2 |
| InChIKey | MKJHIQXDXDLXOV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|