C22H20N6O3 — CID 123286225
1-[3-cyano-5-[5-[formyl(methyl)amino]-3-hydroxy-3-methylpent-1-ynyl]phenyl]pyrazolo[5,4-b]pyridine-3-carboxamide (PubChem CID 123286225) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-[3-cyano-5-[5-[formyl(methyl)amino]-3-hydroxy-3-methylpent-1-ynyl]phenyl]pyrazolo[5,4-b]pyridine-3-carboxamide.
| Compound Name | 1-[3-cyano-5-[5-[formyl(methyl)amino]-3-hydroxy-3-methylpent-1-ynyl]phenyl]pyrazolo[5,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 123286225 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-[3-cyano-5-[5-[formyl(methyl)amino]-3-hydroxy-3-methylpent-1-ynyl]phenyl]pyrazolo[5,4-b]pyridine-3-carboxamide |
| SMILES | CN(C=O)CCC(C)(O)C#Cc1cc(C#N)cc(-n2nc(C(N)=O)c3cccnc32)c1 |
| InChI | InChI=1S/C22H20N6O3/c1-22(31,7-9-27(2)14-29)6-5-15-10-16(13-23)12-17(11-15)28-21-18(4-3-8-25-21)19(26-28)20(24)30/h3-4,8,10-12,14,31H,7,9H2,1-2H3,(H2,24,30) |
| InChIKey | HIPYFPFZAJIYRT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 138.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|