C21H18F3N5O3 — CID 144793174
1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]-5-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-3-carboxamide (PubChem CID 144793174) has the molecular formula C21H18F3N5O3 and a molecular weight of 445.40 g/mol. Its IUPAC name is 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]-5-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-3-carboxamide.
| Compound Name | 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]-5-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144793174 |
| Molecular Formula | C21H18F3N5O3 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]-5-(trifluoromethyl)phenyl]pyrazolo[5,4-b]pyridine-3-carboxamide |
| SMILES | CN(C=O)CC[C@@H](O)C#Cc1cc(-n2nc(C(N)=O)c3cccnc32)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H18F3N5O3/c1-28(12-30)8-6-16(31)5-4-13-9-14(21(22,23)24)11-15(10-13)29-20-17(3-2-7-26-20)18(27-29)19(25)32/h2-3,7,9-12,16,31H,6,8H2,1H3,(H2,25,32)/t16-/m0/s1 |
| InChIKey | IXYHBTSOPWKQBQ-INIZCTEOSA-N |
| XLogP | 1.73 |
| TPSA | 114.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|