C21H24N4O4 — CID 144793153
(4R)-1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-4-hydroxy-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 144793153) has the molecular formula C21H24N4O4 and a molecular weight of 396.45 g/mol. Its IUPAC name is (4R)-1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-4-hydroxy-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | (4R)-1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-4-hydroxy-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 144793153 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | (4R)-1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-4-hydroxy-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CN(C=O)CC[C@@H](O)C#Cc1cccc(-n2nc(C(N)=O)c3c2CCC[C@H]3O)c1 |
| InChI | InChI=1S/C21H24N4O4/c1-24(13-26)11-10-16(27)9-8-14-4-2-5-15(12-14)25-17-6-3-7-18(28)19(17)20(23-25)21(22)29/h2,4-5,12-13,16,18,27-28H,3,6-7,10-11H2,1H3,(H2,22,29)/t16-,18+/m0/s1 |
| InChIKey | HXWHVGBVWCEQQE-FUHWJXTLSA-N |
| XLogP | 0.53 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|