C24H20F2N4O3 — CID 144793955
6-(3,5-difluorophenyl)-2-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]pyrimidine-4-carboxamide (PubChem CID 144793955) has the molecular formula C24H20F2N4O3 and a molecular weight of 450.45 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-2-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(3,5-difluorophenyl)-2-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 144793955 |
| Molecular Formula | C24H20F2N4O3 |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 6-(3,5-difluorophenyl)-2-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]pyrimidine-4-carboxamide |
| SMILES | CN(C=O)CC[C@@H](O)C#Cc1cccc(-c2nc(C(N)=O)cc(-c3cc(F)cc(F)c3)n2)c1 |
| InChI | InChI=1S/C24H20F2N4O3/c1-30(14-31)8-7-20(32)6-5-15-3-2-4-16(9-15)24-28-21(13-22(29-24)23(27)33)17-10-18(25)12-19(26)11-17/h2-4,9-14,20,32H,7-8H2,1H3,(H2,27,33)/t20-/m0/s1 |
| InChIKey | YLJVWIUAGKFDBG-FQEVSTJZSA-N |
| XLogP | 2.38 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|