C23H29N5O3 — CID 144793808
N,N-dimethylethanamine;2-[3-(3-hydroxy-4-oxobut-1-ynyl)phenyl]-6-pyrrolidin-1-ylpyrimidine-4-carboxamide (PubChem CID 144793808) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is N,N-dimethylethanamine;2-[3-(3-hydroxy-4-oxobut-1-ynyl)phenyl]-6-pyrrolidin-1-ylpyrimidine-4-carboxamide.
| Compound Name | N,N-dimethylethanamine;2-[3-(3-hydroxy-4-oxobut-1-ynyl)phenyl]-6-pyrrolidin-1-ylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 144793808 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N,N-dimethylethanamine;2-[3-(3-hydroxy-4-oxobut-1-ynyl)phenyl]-6-pyrrolidin-1-ylpyrimidine-4-carboxamide |
| SMILES | CCN(C)C.NC(=O)c1cc(N2CCCC2)nc(-c2cccc(C#CC(O)C=O)c2)n1 |
| InChI | InChI=1S/C19H18N4O3.C4H11N/c20-18(26)16-11-17(23-8-1-2-9-23)22-19(21-16)14-5-3-4-13(10-14)6-7-15(25)12-24;1-4-5(2)3/h3-5,10-12,15,25H,1-2,8-9H2,(H2,20,26);4H2,1-3H3 |
| InChIKey | FJEZAJIAUVPBSO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|