C26H22F2N4O3 — CID 144793954
acetylene;6-(3,5-difluorophenyl)-2-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]pyrimidine-4-carboxamide (PubChem CID 144793954) has the molecular formula C26H22F2N4O3 and a molecular weight of 476.48 g/mol. Its IUPAC name is acetylene;6-(3,5-difluorophenyl)-2-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]pyrimidine-4-carboxamide.
| Compound Name | acetylene;6-(3,5-difluorophenyl)-2-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 144793954 |
| Molecular Formula | C26H22F2N4O3 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | acetylene;6-(3,5-difluorophenyl)-2-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]pyrimidine-4-carboxamide |
| SMILES | C#C.CN(C=O)CC[C@@H](O)C#Cc1cccc(-c2nc(C(N)=O)cc(-c3cc(F)cc(F)c3)n2)c1 |
| InChI | InChI=1S/C24H20F2N4O3.C2H2/c1-30(14-31)8-7-20(32)6-5-15-3-2-4-16(9-15)24-28-21(13-22(29-24)23(27)33)17-10-18(25)12-19(26)11-17;1-2/h2-4,9-14,20,32H,7-8H2,1H3,(H2,27,33);1-2H/t20-;/m0./s1 |
| InChIKey | FKGJJEPNGHVJKC-BDQAORGHSA-N |
| XLogP | 2.63 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|