C25H22F2N4O3 — CID 123704686
6-(2,5-difluorophenyl)-2-[3-[5-[formyl(methyl)amino]-3-hydroxy-3-methylpent-1-ynyl]phenyl]pyrimidine-4-carboxamide (PubChem CID 123704686) has the molecular formula C25H22F2N4O3 and a molecular weight of 464.47 g/mol. Its IUPAC name is 6-(2,5-difluorophenyl)-2-[3-[5-[formyl(methyl)amino]-3-hydroxy-3-methylpent-1-ynyl]phenyl]pyrimidine-4-carboxamide.
| Compound Name | 6-(2,5-difluorophenyl)-2-[3-[5-[formyl(methyl)amino]-3-hydroxy-3-methylpent-1-ynyl]phenyl]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 123704686 |
| Molecular Formula | C25H22F2N4O3 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 6-(2,5-difluorophenyl)-2-[3-[5-[formyl(methyl)amino]-3-hydroxy-3-methylpent-1-ynyl]phenyl]pyrimidine-4-carboxamide |
| SMILES | CN(C=O)CCC(C)(O)C#Cc1cccc(-c2nc(C(N)=O)cc(-c3cc(F)ccc3F)n2)c1 |
| InChI | InChI=1S/C25H22F2N4O3/c1-25(34,10-11-31(2)15-32)9-8-16-4-3-5-17(12-16)24-29-21(14-22(30-24)23(28)33)19-13-18(26)6-7-20(19)27/h3-7,12-15,34H,10-11H2,1-2H3,(H2,28,33) |
| InChIKey | RTSRQWUOYULHFS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|