C21H19ClN4O3 — CID 144793652
3-chloro-5-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide (PubChem CID 144793652) has the molecular formula C21H19ClN4O3 and a molecular weight of 410.86 g/mol. Its IUPAC name is 3-chloro-5-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide.
| Compound Name | 3-chloro-5-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 144793652 |
| Molecular Formula | C21H19ClN4O3 |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-chloro-5-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-1H-pyrrolo[2,3-c]pyridine-7-carboxamide |
| SMILES | CN(C=O)CC[C@@H](O)C#Cc1cccc(-c2cc3c(Cl)c[nH]c3c(C(N)=O)n2)c1 |
| InChI | InChI=1S/C21H19ClN4O3/c1-26(12-27)8-7-15(28)6-5-13-3-2-4-14(9-13)18-10-16-17(22)11-24-19(16)20(25-18)21(23)29/h2-4,9-12,15,24,28H,7-8H2,1H3,(H2,23,29)/t15-/m0/s1 |
| InChIKey | CKXJZMHVROJTGZ-HNNXBMFYSA-N |
| XLogP | 2.17 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|