C25H29N5O2 — CID 144793788
ethane;N-[3-hydroxy-5-[3-[6-prop-1-en-2-yl-4-(1,2,4-triazol-1-yl)-2-pyridinyl]phenyl]pent-4-ynyl]-N-methylformamide (PubChem CID 144793788) has the molecular formula C25H29N5O2 and a molecular weight of 431.54 g/mol. Its IUPAC name is ethane;N-[3-hydroxy-5-[3-[6-prop-1-en-2-yl-4-(1,2,4-triazol-1-yl)-2-pyridinyl]phenyl]pent-4-ynyl]-N-methylformamide.
| Compound Name | ethane;N-[3-hydroxy-5-[3-[6-prop-1-en-2-yl-4-(1,2,4-triazol-1-yl)-2-pyridinyl]phenyl]pent-4-ynyl]-N-methylformamide |
|---|---|
| PubChem CID | 144793788 |
| Molecular Formula | C25H29N5O2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.23 |
| IUPAC Name | ethane;N-[3-hydroxy-5-[3-[6-prop-1-en-2-yl-4-(1,2,4-triazol-1-yl)-2-pyridinyl]phenyl]pent-4-ynyl]-N-methylformamide |
| SMILES | C=C(C)c1cc(-n2cncn2)cc(-c2cccc(C#CC(O)CCN(C)C=O)c2)n1.CC |
| InChI | InChI=1S/C23H23N5O2.C2H6/c1-17(2)22-12-20(28-15-24-14-25-28)13-23(26-22)19-6-4-5-18(11-19)7-8-21(30)9-10-27(3)16-29;1-2/h4-6,11-16,21,30H,1,9-10H2,2-3H3;1-2H3 |
| InChIKey | WKDRZYYZYZXSBW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|