C23H23N3O5 — CID 144793427
methyl 1-[3-[5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-6-methoxyindazole-3-carboxylate (PubChem CID 144793427) has the molecular formula C23H23N3O5 and a molecular weight of 421.45 g/mol. Its IUPAC name is methyl 1-[3-[5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-6-methoxyindazole-3-carboxylate.
| Compound Name | methyl 1-[3-[5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-6-methoxyindazole-3-carboxylate |
|---|---|
| PubChem CID | 144793427 |
| Molecular Formula | C23H23N3O5 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | methyl 1-[3-[5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-6-methoxyindazole-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2cccc(C#CC(O)CCN(C)C=O)c2)c2cc(OC)ccc12 |
| InChI | InChI=1S/C23H23N3O5/c1-25(15-27)12-11-18(28)8-7-16-5-4-6-17(13-16)26-21-14-19(30-2)9-10-20(21)22(24-26)23(29)31-3/h4-6,9-10,13-15,18,28H,11-12H2,1-3H3 |
| InChIKey | DKEKFPDBERBZDX-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|