C24H26N4O4 — CID 126724950
1-[3-[(3R)-5-(dimethylamino)-3-formyl-3-hydroxypent-1-ynyl]phenyl]-5-[(1S)-1-hydroxyethyl]indazole-3-carboxamide (PubChem CID 126724950) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is 1-[3-[(3R)-5-(dimethylamino)-3-formyl-3-hydroxypent-1-ynyl]phenyl]-5-[(1S)-1-hydroxyethyl]indazole-3-carboxamide.
| Compound Name | 1-[3-[(3R)-5-(dimethylamino)-3-formyl-3-hydroxypent-1-ynyl]phenyl]-5-[(1S)-1-hydroxyethyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 126724950 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[3-[(3R)-5-(dimethylamino)-3-formyl-3-hydroxypent-1-ynyl]phenyl]-5-[(1S)-1-hydroxyethyl]indazole-3-carboxamide |
| SMILES | C[C@H](O)c1ccc2c(c1)c(C(N)=O)nn2-c1cccc(C#C[C@@](O)(C=O)CCN(C)C)c1 |
| InChI | InChI=1S/C24H26N4O4/c1-16(30)18-7-8-21-20(14-18)22(23(25)31)26-28(21)19-6-4-5-17(13-19)9-10-24(32,15-29)11-12-27(2)3/h4-8,13-16,30,32H,11-12H2,1-3H3,(H2,25,31)/t16-,24-/m0/s1 |
| InChIKey | NZXXCZRLCWNMJS-FYSMJZIKSA-N |
| XLogP | 1.41 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|