C20H20N6O4 — CID 144792770
1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-6-methoxypyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 144792770) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-6-methoxypyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-6-methoxypyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 144792770 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 1-[3-[(3R)-5-[formyl(methyl)amino]-3-hydroxypent-1-ynyl]phenyl]-6-methoxypyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | COc1ncc2c(C(N)=O)nn(-c3cccc(C#C[C@H](O)CCN(C)C=O)c3)c2n1 |
| InChI | InChI=1S/C20H20N6O4/c1-25(12-27)9-8-15(28)7-6-13-4-3-5-14(10-13)26-19-16(17(24-26)18(21)29)11-22-20(23-19)30-2/h3-5,10-12,15,28H,8-9H2,1-2H3,(H2,21,29)/t15-/m0/s1 |
| InChIKey | UTVKESUYTHMIIG-HNNXBMFYSA-N |
| XLogP | 0.11 |
| TPSA | 136.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|