C15H11N5O2 — CID 123403814
1-(3-ethynylphenyl)-5-methoxypyrazolo[3,4-c]pyridazine-3-carboxamide (PubChem CID 123403814) has the molecular formula C15H11N5O2 and a molecular weight of 293.29 g/mol. Its IUPAC name is 1-(3-ethynylphenyl)-5-methoxypyrazolo[3,4-c]pyridazine-3-carboxamide.
| Compound Name | 1-(3-ethynylphenyl)-5-methoxypyrazolo[3,4-c]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 123403814 |
| Molecular Formula | C15H11N5O2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-(3-ethynylphenyl)-5-methoxypyrazolo[3,4-c]pyridazine-3-carboxamide |
| SMILES | C#Cc1cccc(-n2nc(C(N)=O)c3cc(OC)nnc32)c1 |
| InChI | InChI=1S/C15H11N5O2/c1-3-9-5-4-6-10(7-9)20-15-11(13(19-20)14(16)21)8-12(22-2)17-18-15/h1,4-8H,2H3,(H2,16,21) |
| InChIKey | MOVHXCKOQNQTJS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|