C15H11F2N3O — CID 144793261
1-(3-ethynylphenyl)-5,5-difluoro-4,6-dihydrocyclopenta[d]pyrazole-3-carboxamide (PubChem CID 144793261) has the molecular formula C15H11F2N3O and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-(3-ethynylphenyl)-5,5-difluoro-4,6-dihydrocyclopenta[d]pyrazole-3-carboxamide.
| Compound Name | 1-(3-ethynylphenyl)-5,5-difluoro-4,6-dihydrocyclopenta[d]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 144793261 |
| Molecular Formula | C15H11F2N3O |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-(3-ethynylphenyl)-5,5-difluoro-4,6-dihydrocyclopenta[d]pyrazole-3-carboxamide |
| SMILES | C#Cc1cccc(-n2nc(C(N)=O)c3c2CC(F)(F)C3)c1 |
| InChI | InChI=1S/C15H11F2N3O/c1-2-9-4-3-5-10(6-9)20-12-8-15(16,17)7-11(12)13(19-20)14(18)21/h1,3-6H,7-8H2,(H2,18,21) |
| InChIKey | ALXCGUOQUOSLQD-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|