C19H21N5O3 — CID 145143343
acetylene;4-amino-1-(3-ethynylphenyl)pyrazole-3-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 145143343) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is acetylene;4-amino-1-(3-ethynylphenyl)pyrazole-3-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | acetylene;4-amino-1-(3-ethynylphenyl)pyrazole-3-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 145143343 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | acetylene;4-amino-1-(3-ethynylphenyl)pyrazole-3-carboxamide;(3S)-3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#C.C#Cc1cccc(-n2cc(N)c(C(N)=O)n2)c1.CN1CC[C@H](O)C1=O |
| InChI | InChI=1S/C12H10N4O.C5H9NO2.C2H2/c1-2-8-4-3-5-9(6-8)16-7-10(13)11(15-16)12(14)17;1-6-3-2-4(7)5(6)8;1-2/h1,3-7H,13H2,(H2,14,17);4,7H,2-3H2,1H3;1-2H/t;4-;/m.0./s1 |
| InChIKey | LWAPKUHBUKYYEI-INZIHYEWSA-N |
| XLogP | -0.01 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|