C18H20N4O5S2 — CID 145143406
2-(3-ethynylphenyl)-5-(methanesulfonamido)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 145143406) has the molecular formula C18H20N4O5S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-(3-ethynylphenyl)-5-(methanesulfonamido)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | 2-(3-ethynylphenyl)-5-(methanesulfonamido)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 145143406 |
| Molecular Formula | C18H20N4O5S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | 2-(3-ethynylphenyl)-5-(methanesulfonamido)-1,3-thiazole-4-carboxamide;3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#Cc1cccc(-c2nc(C(N)=O)c(NS(C)(=O)=O)s2)c1.CN1CCC(O)C1=O |
| InChI | InChI=1S/C13H11N3O3S2.C5H9NO2/c1-3-8-5-4-6-9(7-8)12-15-10(11(14)17)13(20-12)16-21(2,18)19;1-6-3-2-4(7)5(6)8/h1,4-7,16H,2H3,(H2,14,17);4,7H,2-3H2,1H3 |
| InChIKey | WGJSJDWCUZFULN-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 142.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|