C19H24N4O3S — CID 145143255
5-amino-2-(3-ethynylphenyl)-1,3-thiazole-4-carboxamide;ethane;3-hydroxy-1-methylpyrrolidin-2-one (PubChem CID 145143255) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is 5-amino-2-(3-ethynylphenyl)-1,3-thiazole-4-carboxamide;ethane;3-hydroxy-1-methylpyrrolidin-2-one.
| Compound Name | 5-amino-2-(3-ethynylphenyl)-1,3-thiazole-4-carboxamide;ethane;3-hydroxy-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 145143255 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 5-amino-2-(3-ethynylphenyl)-1,3-thiazole-4-carboxamide;ethane;3-hydroxy-1-methylpyrrolidin-2-one |
| SMILES | C#Cc1cccc(-c2nc(C(N)=O)c(N)s2)c1.CC.CN1CCC(O)C1=O |
| InChI | InChI=1S/C12H9N3OS.C5H9NO2.C2H6/c1-2-7-4-3-5-8(6-7)12-15-9(10(13)16)11(14)17-12;1-6-3-2-4(7)5(6)8;1-2/h1,3-6H,14H2,(H2,13,16);4,7H,2-3H2,1H3;1-2H3 |
| InChIKey | QBTFZZTVMWZFKV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|